C12H7BrClN3 — CID 117133109
5-bromo-2-(2-chlorophenyl)-[1,2,4]triazolo[1,5-a]pyridine (PubChem CID 117133109) has the molecular formula C12H7BrClN3 and a molecular weight of 308.57 g/mol. Its IUPAC name is 5-bromo-2-(2-chlorophenyl)-[1,2,4]triazolo[1,5-a]pyridine.
| Compound Name | 5-bromo-2-(2-chlorophenyl)-[1,2,4]triazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 117133109 |
| Molecular Formula | C12H7BrClN3 |
| Molecular Weight | 308.57 g/mol |
| Exact Mass | 306.95 |
| IUPAC Name | 5-bromo-2-(2-chlorophenyl)-[1,2,4]triazolo[1,5-a]pyridine |
| SMILES | Clc1ccccc1-c1nc2cccc(Br)n2n1 |
| InChI | InChI=1S/C12H7BrClN3/c13-10-6-3-7-11-15-12(16-17(10)11)8-4-1-2-5-9(8)14/h1-7H |
| InChIKey | UIJHKIZTYCOISJ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.57 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|