C11H14N4O — CID 117133668
2-piperidin-4-yl-3H-[1,2,4]triazolo[1,5-a]pyridin-7-one (PubChem CID 117133668) has the molecular formula C11H14N4O and a molecular weight of 218.26 g/mol. Its IUPAC name is 2-piperidin-4-yl-3H-[1,2,4]triazolo[1,5-a]pyridin-7-one.
| Compound Name | 2-piperidin-4-yl-3H-[1,2,4]triazolo[1,5-a]pyridin-7-one |
|---|---|
| PubChem CID | 117133668 |
| Molecular Formula | C11H14N4O |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | 2-piperidin-4-yl-3H-[1,2,4]triazolo[1,5-a]pyridin-7-one |
| SMILES | O=c1ccn2[nH]c(C3CCNCC3)nc2c1 |
| InChI | InChI=1S/C11H14N4O/c16-9-3-6-15-10(7-9)13-11(14-15)8-1-4-12-5-2-8/h3,6-8,12H,1-2,4-5H2,(H,13,14) |
| InChIKey | HWINRUCVMKRONQ-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 62.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |