C14H17N3O2 — CID 115054704
2-(piperidin-4-ylmethyl)-1H-pyrido[1,2-a]pyrimidine-4,8-dione (PubChem CID 115054704) has the molecular formula C14H17N3O2 and a molecular weight of 259.31 g/mol. Its IUPAC name is 2-(piperidin-4-ylmethyl)-1H-pyrido[1,2-a]pyrimidine-4,8-dione.
| Compound Name | 2-(piperidin-4-ylmethyl)-1H-pyrido[1,2-a]pyrimidine-4,8-dione |
|---|---|
| PubChem CID | 115054704 |
| Molecular Formula | C14H17N3O2 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.13 |
| IUPAC Name | 2-(piperidin-4-ylmethyl)-1H-pyrido[1,2-a]pyrimidine-4,8-dione |
| SMILES | O=c1ccn2c(=O)cc(CC3CCNCC3)[nH]c2c1 |
| InChI | InChI=1S/C14H17N3O2/c18-12-3-6-17-13(9-12)16-11(8-14(17)19)7-10-1-4-15-5-2-10/h3,6,8-10,15-16H,1-2,4-5,7H2 |
| InChIKey | SIWLDVRCBLJAJO-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 66.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |