C13H17N3O — CID 105489718
2-(piperidin-3-ylmethyl)-1H-imidazo[1,2-a]pyridin-7-one (PubChem CID 105489718) has the molecular formula C13H17N3O and a molecular weight of 231.30 g/mol. Its IUPAC name is 2-(piperidin-3-ylmethyl)-1H-imidazo[1,2-a]pyridin-7-one.
| Compound Name | 2-(piperidin-3-ylmethyl)-1H-imidazo[1,2-a]pyridin-7-one |
|---|---|
| PubChem CID | 105489718 |
| Molecular Formula | C13H17N3O |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.14 |
| IUPAC Name | 2-(piperidin-3-ylmethyl)-1H-imidazo[1,2-a]pyridin-7-one |
| SMILES | O=c1ccn2cc(CC3CCCNC3)[nH]c2c1 |
| InChI | InChI=1S/C13H17N3O/c17-12-3-5-16-9-11(15-13(16)7-12)6-10-2-1-4-14-8-10/h3,5,7,9-10,14-15H,1-2,4,6,8H2 |
| InChIKey | LKDSKMHLLIXFFV-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 49.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |