C8H14N4O — CID 136966014
2-methyl-5-piperidin-4-yl-4H-1,2,4-triazol-3-one (PubChem CID 136966014) has the molecular formula C8H14N4O and a molecular weight of 182.23 g/mol. Its IUPAC name is 2-methyl-5-piperidin-4-yl-4H-1,2,4-triazol-3-one.
| Compound Name | 2-methyl-5-piperidin-4-yl-4H-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 136966014 |
| Molecular Formula | C8H14N4O |
| Molecular Weight | 182.23 g/mol |
| Exact Mass | 182.12 |
| IUPAC Name | 2-methyl-5-piperidin-4-yl-4H-1,2,4-triazol-3-one |
| SMILES | Cn1nc(C2CCNCC2)[nH]c1=O |
| InChI | InChI=1S/C8H14N4O/c1-12-8(13)10-7(11-12)6-2-4-9-5-3-6/h6,9H,2-5H2,1H3,(H,10,11,13) |
| InChIKey | FQVJZQHEDGGCRM-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 62.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.23 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |