C10H13N5O2 — CID 114402296
8-piperidin-4-yl-3,7-dihydropurine-2,6-dione (PubChem CID 114402296) has the molecular formula C10H13N5O2 and a molecular weight of 235.25 g/mol. Its IUPAC name is 8-piperidin-4-yl-3,7-dihydropurine-2,6-dione.
| Compound Name | 8-piperidin-4-yl-3,7-dihydropurine-2,6-dione |
|---|---|
| PubChem CID | 114402296 |
| Molecular Formula | C10H13N5O2 |
| Molecular Weight | 235.25 g/mol |
| Exact Mass | 235.11 |
| IUPAC Name | 8-piperidin-4-yl-3,7-dihydropurine-2,6-dione |
| SMILES | O=c1[nH]c(=O)c2[nH]c(C3CCNCC3)nc2[nH]1 |
| InChI | InChI=1S/C10H13N5O2/c16-9-6-8(14-10(17)15-9)13-7(12-6)5-1-3-11-4-2-5/h5,11H,1-4H2,(H3,12,13,14,15,16,17) |
| InChIKey | KUAPQYSBHGVZKX-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 106.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.25 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |