C9H12ClN3O2 — CID 83867955
5-chloro-6-piperidin-4-yl-1H-pyrimidine-2,4-dione (PubChem CID 83867955) has the molecular formula C9H12ClN3O2 and a molecular weight of 229.67 g/mol. Its IUPAC name is 5-chloro-6-piperidin-4-yl-1H-pyrimidine-2,4-dione.
| Compound Name | 5-chloro-6-piperidin-4-yl-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 83867955 |
| Molecular Formula | C9H12ClN3O2 |
| Molecular Weight | 229.67 g/mol |
| Exact Mass | 229.06 |
| IUPAC Name | 5-chloro-6-piperidin-4-yl-1H-pyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(C2CCNCC2)c(Cl)c(=O)[nH]1 |
| InChI | InChI=1S/C9H12ClN3O2/c10-6-7(5-1-3-11-4-2-5)12-9(15)13-8(6)14/h5,11H,1-4H2,(H2,12,13,14,15) |
| InChIKey | ZKEXDZJOENRYOM-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 77.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.67 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |