C13H10N4O2S — CID 114402794
8-(2,3-dihydro-1-benzothiophen-2-yl)-3,7-dihydropurine-2,6-dione (PubChem CID 114402794) has the molecular formula C13H10N4O2S and a molecular weight of 286.32 g/mol. Its IUPAC name is 8-(2,3-dihydro-1-benzothiophen-2-yl)-3,7-dihydropurine-2,6-dione.
| Compound Name | 8-(2,3-dihydro-1-benzothiophen-2-yl)-3,7-dihydropurine-2,6-dione |
|---|---|
| PubChem CID | 114402794 |
| Molecular Formula | C13H10N4O2S |
| Molecular Weight | 286.32 g/mol |
| Exact Mass | 286.05 |
| IUPAC Name | 8-(2,3-dihydro-1-benzothiophen-2-yl)-3,7-dihydropurine-2,6-dione |
| SMILES | O=c1[nH]c(=O)c2[nH]c(C3Cc4ccccc4S3)nc2[nH]1 |
| InChI | InChI=1S/C13H10N4O2S/c18-12-9-11(16-13(19)17-12)15-10(14-9)8-5-6-3-1-2-4-7(6)20-8/h1-4,8H,5H2,(H3,14,15,16,17,18,19) |
| InChIKey | VTUMXHMCDYDIOX-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 94.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.32 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |