C11H10N4S2 — CID 83240312
2-amino-6-(2,3-dihydro-1-benzothiophen-2-yl)-1H-1,3,5-triazine-4-thione (PubChem CID 83240312) has the molecular formula C11H10N4S2 and a molecular weight of 262.36 g/mol. Its IUPAC name is 2-amino-6-(2,3-dihydro-1-benzothiophen-2-yl)-1H-1,3,5-triazine-4-thione.
| Compound Name | 2-amino-6-(2,3-dihydro-1-benzothiophen-2-yl)-1H-1,3,5-triazine-4-thione |
|---|---|
| PubChem CID | 83240312 |
| Molecular Formula | C11H10N4S2 |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.03 |
| IUPAC Name | 2-amino-6-(2,3-dihydro-1-benzothiophen-2-yl)-1H-1,3,5-triazine-4-thione |
| SMILES | Nc1nc(=S)nc(C2Cc3ccccc3S2)[nH]1 |
| InChI | InChI=1S/C11H10N4S2/c12-10-13-9(14-11(16)15-10)8-5-6-3-1-2-4-7(6)17-8/h1-4,8H,5H2,(H3,12,13,14,15,16) |
| InChIKey | NKYKUTVEMAMWEV-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|