C12H13F3N4O2 — CID 114402832
8-[4-(trifluoromethyl)cyclohexyl]-3,7-dihydropurine-2,6-dione (PubChem CID 114402832) has the molecular formula C12H13F3N4O2 and a molecular weight of 302.26 g/mol. Its IUPAC name is 8-[4-(trifluoromethyl)cyclohexyl]-3,7-dihydropurine-2,6-dione.
| Compound Name | 8-[4-(trifluoromethyl)cyclohexyl]-3,7-dihydropurine-2,6-dione |
|---|---|
| PubChem CID | 114402832 |
| Molecular Formula | C12H13F3N4O2 |
| Molecular Weight | 302.26 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | 8-[4-(trifluoromethyl)cyclohexyl]-3,7-dihydropurine-2,6-dione |
| SMILES | O=c1[nH]c(=O)c2[nH]c(C3CCC(C(F)(F)F)CC3)nc2[nH]1 |
| InChI | InChI=1S/C12H13F3N4O2/c13-12(14,15)6-3-1-5(2-4-6)8-16-7-9(17-8)18-11(21)19-10(7)20/h5-6H,1-4H2,(H3,16,17,18,19,20,21) |
| InChIKey | WMVIHSZWXFEHLQ-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 94.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.26 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |