About [bis(prop-2-enyl)amino] benzoate
[bis(prop-2-enyl)amino] benzoate (PubChem CID 11715496) has the molecular formula C13H15NO2
and a molecular weight of 217.27 g/mol. Its IUPAC name is [bis(prop-2-enyl)amino] benzoate.
Molecular Properties
| Compound Name | [bis(prop-2-enyl)amino] benzoate |
| PubChem CID | 11715496 |
| Molecular Formula | C13H15NO2 |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | [bis(prop-2-enyl)amino] benzoate |
| SMILES | C=CCN(CC=C)OC(=O)c1ccccc1 |
| InChI | InChI=1S/C13H15NO2/c1-3-10-14(11-4-2)16-13(15)12-8-6-5-7-9-12/h3-9H,1-2,10-11H2 |
| InChIKey | YOJATWQKZIJCOY-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [bis(prop-2-enyl)amino] benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [bis(prop-2-enyl)amino] benzoate?
The IUPAC name of [bis(prop-2-enyl)amino] benzoate (CID 11715496) is [bis(prop-2-enyl)amino] benzoate.
What is the SMILES notation for [bis(prop-2-enyl)amino] benzoate?
The canonical SMILES for [bis(prop-2-enyl)amino] benzoate is C=CCN(CC=C)OC(=O)c1ccccc1.
What is the InChIKey of [bis(prop-2-enyl)amino] benzoate?
The InChIKey is YOJATWQKZIJCOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15NO2/c1-3-10-14(11-4-2)16-13(15)12-8-6-5-7-9-12/h3-9H,1-2,10-11H2.
What are the key properties of [bis(prop-2-enyl)amino] benzoate?
[bis(prop-2-enyl)amino] benzoate has a molecular weight of 217.27 g/mol, XLogP of 2.43, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [bis(prop-2-enyl)amino] benzoate is sourced from PubChem (CID 11715496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).