C12H10N4O — CID 117158565
3-(2-aminophenyl)-[1,2,4]triazolo[4,3-a]pyridin-8-ol (PubChem CID 117158565) has the molecular formula C12H10N4O and a molecular weight of 226.24 g/mol. Its IUPAC name is 3-(2-aminophenyl)-[1,2,4]triazolo[4,3-a]pyridin-8-ol.
| Compound Name | 3-(2-aminophenyl)-[1,2,4]triazolo[4,3-a]pyridin-8-ol |
|---|---|
| PubChem CID | 117158565 |
| Molecular Formula | C12H10N4O |
| Molecular Weight | 226.24 g/mol |
| Exact Mass | 226.09 |
| IUPAC Name | 3-(2-aminophenyl)-[1,2,4]triazolo[4,3-a]pyridin-8-ol |
| SMILES | Nc1ccccc1-c1nnc2c(O)cccn12 |
| InChI | InChI=1S/C12H10N4O/c13-9-5-2-1-4-8(9)11-14-15-12-10(17)6-3-7-16(11)12/h1-7,17H,13H2 |
| InChIKey | AUZKDAYSOTTYNK-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 76.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.24 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|