C13H15N3O — CID 117158694
3-(3-aminophenyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-7-ol (PubChem CID 117158694) has the molecular formula C13H15N3O and a molecular weight of 229.28 g/mol. Its IUPAC name is 3-(3-aminophenyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-7-ol.
| Compound Name | 3-(3-aminophenyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-7-ol |
|---|---|
| PubChem CID | 117158694 |
| Molecular Formula | C13H15N3O |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.12 |
| IUPAC Name | 3-(3-aminophenyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-7-ol |
| SMILES | Nc1cccc(-c2ncc3n2CCC(O)C3)c1 |
| InChI | InChI=1S/C13H15N3O/c14-10-3-1-2-9(6-10)13-15-8-11-7-12(17)4-5-16(11)13/h1-3,6,8,12,17H,4-5,7,14H2 |
| InChIKey | UJSYWCYQFROIHU-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|