C8H13NO3 — CID 117158831
4-(oxolan-3-ylmethyl)-1,3-oxazolidin-2-one (PubChem CID 117158831) has the molecular formula C8H13NO3 and a molecular weight of 171.20 g/mol. Its IUPAC name is 4-(oxolan-3-ylmethyl)-1,3-oxazolidin-2-one.
| Compound Name | 4-(oxolan-3-ylmethyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 117158831 |
| Molecular Formula | C8H13NO3 |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.09 |
| IUPAC Name | 4-(oxolan-3-ylmethyl)-1,3-oxazolidin-2-one |
| SMILES | O=C1NC(CC2CCOC2)CO1 |
| InChI | InChI=1S/C8H13NO3/c10-8-9-7(5-12-8)3-6-1-2-11-4-6/h6-7H,1-5H2,(H,9,10) |
| InChIKey | DMFFHZBDVVQNHL-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |