C9H15NO2S — CID 117158944
5-methyl-5-(thian-2-yl)-1,3-oxazolidin-2-one (PubChem CID 117158944) has the molecular formula C9H15NO2S and a molecular weight of 201.29 g/mol. Its IUPAC name is 5-methyl-5-(thian-2-yl)-1,3-oxazolidin-2-one.
| Compound Name | 5-methyl-5-(thian-2-yl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 117158944 |
| Molecular Formula | C9H15NO2S |
| Molecular Weight | 201.29 g/mol |
| Exact Mass | 201.08 |
| IUPAC Name | 5-methyl-5-(thian-2-yl)-1,3-oxazolidin-2-one |
| SMILES | CC1(C2CCCCS2)CNC(=O)O1 |
| InChI | InChI=1S/C9H15NO2S/c1-9(6-10-8(11)12-9)7-4-2-3-5-13-7/h7H,2-6H2,1H3,(H,10,11) |
| InChIKey | QZAZMCDLURGQBQ-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.29 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |