C11H9N5 — CID 117159529
4-(triazolo[4,5-c]pyridin-1-yl)aniline (PubChem CID 117159529) has the molecular formula C11H9N5 and a molecular weight of 211.23 g/mol. Its IUPAC name is 4-(triazolo[4,5-c]pyridin-1-yl)aniline.
| Compound Name | 4-(triazolo[4,5-c]pyridin-1-yl)aniline |
|---|---|
| PubChem CID | 117159529 |
| Molecular Formula | C11H9N5 |
| Molecular Weight | 211.23 g/mol |
| Exact Mass | 211.09 |
| IUPAC Name | 4-(triazolo[4,5-c]pyridin-1-yl)aniline |
| SMILES | Nc1ccc(-n2nnc3cnccc32)cc1 |
| InChI | InChI=1S/C11H9N5/c12-8-1-3-9(4-2-8)16-11-5-6-13-7-10(11)14-15-16/h1-7H,12H2 |
| InChIKey | BWLBNRAWKULOMU-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.23 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|