C18H19N3S — CID 117160981
3-(4-methylphenyl)-2-(thian-4-yl)imidazo[4,5-b]pyridine (PubChem CID 117160981) has the molecular formula C18H19N3S and a molecular weight of 309.44 g/mol. Its IUPAC name is 3-(4-methylphenyl)-2-(thian-4-yl)imidazo[4,5-b]pyridine.
| Compound Name | 3-(4-methylphenyl)-2-(thian-4-yl)imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 117160981 |
| Molecular Formula | C18H19N3S |
| Molecular Weight | 309.44 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | 3-(4-methylphenyl)-2-(thian-4-yl)imidazo[4,5-b]pyridine |
| SMILES | Cc1ccc(-n2c(C3CCSCC3)nc3cccnc32)cc1 |
| InChI | InChI=1S/C18H19N3S/c1-13-4-6-15(7-5-13)21-17(14-8-11-22-12-9-14)20-16-3-2-10-19-18(16)21/h2-7,10,14H,8-9,11-12H2,1H3 |
| InChIKey | ULIBEEFOVRXAOZ-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.44 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |