C17H16FN3S — CID 117160982
3-(4-fluorophenyl)-2-(thian-4-yl)imidazo[4,5-b]pyridine (PubChem CID 117160982) has the molecular formula C17H16FN3S and a molecular weight of 313.40 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-2-(thian-4-yl)imidazo[4,5-b]pyridine.
| Compound Name | 3-(4-fluorophenyl)-2-(thian-4-yl)imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 117160982 |
| Molecular Formula | C17H16FN3S |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | 3-(4-fluorophenyl)-2-(thian-4-yl)imidazo[4,5-b]pyridine |
| SMILES | Fc1ccc(-n2c(C3CCSCC3)nc3cccnc32)cc1 |
| InChI | InChI=1S/C17H16FN3S/c18-13-3-5-14(6-4-13)21-16(12-7-10-22-11-8-12)20-15-2-1-9-19-17(15)21/h1-6,9,12H,7-8,10-11H2 |
| InChIKey | BAYMTQKAYJRDFC-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |