C15H14N4S — CID 117160375
3-pyridin-3-yl-2-(thiolan-3-yl)imidazo[4,5-b]pyridine (PubChem CID 117160375) has the molecular formula C15H14N4S and a molecular weight of 282.37 g/mol. Its IUPAC name is 3-pyridin-3-yl-2-(thiolan-3-yl)imidazo[4,5-b]pyridine.
| Compound Name | 3-pyridin-3-yl-2-(thiolan-3-yl)imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 117160375 |
| Molecular Formula | C15H14N4S |
| Molecular Weight | 282.37 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | 3-pyridin-3-yl-2-(thiolan-3-yl)imidazo[4,5-b]pyridine |
| SMILES | c1cncc(-n2c(C3CCSC3)nc3cccnc32)c1 |
| InChI | InChI=1S/C15H14N4S/c1-3-12(9-16-6-1)19-14(11-5-8-20-10-11)18-13-4-2-7-17-15(13)19/h1-4,6-7,9,11H,5,8,10H2 |
| InChIKey | YWBCSEMYCCLHKA-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.37 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |