C19H22O4 — CID 11716632
dimethyl (1S,5S)-1-methyl-5-(1-phenylethenyl)bicyclo[3.1.0]hexane-3,3-dicarboxylate (PubChem CID 11716632) has the molecular formula C19H22O4 and a molecular weight of 314.38 g/mol. Its IUPAC name is dimethyl (1S,5S)-1-methyl-5-(1-phenylethenyl)bicyclo[3.1.0]hexane-3,3-dicarboxylate.
| Compound Name | dimethyl (1S,5S)-1-methyl-5-(1-phenylethenyl)bicyclo[3.1.0]hexane-3,3-dicarboxylate |
|---|---|
| PubChem CID | 11716632 |
| Molecular Formula | C19H22O4 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | dimethyl (1S,5S)-1-methyl-5-(1-phenylethenyl)bicyclo[3.1.0]hexane-3,3-dicarboxylate |
| SMILES | C=C(c1ccccc1)[C@@]12CC(C(=O)OC)(C(=O)OC)C[C@]1(C)C2 |
| InChI | InChI=1S/C19H22O4/c1-13(14-8-6-5-7-9-14)19-11-17(19,2)10-18(12-19,15(20)22-3)16(21)23-4/h5-9H,1,10-12H2,2-4H3/t17-,19-/m1/s1 |
| InChIKey | LRUHXBGEHYVQKJ-IEBWSBKVSA-N |
| XLogP | 3.22 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|