6-(4-hydroxyphenyl)piperidine-3-carboxylic acid

C12H15NO3 — CID 117168119

IUPAC6-(4-hydroxyphenyl)piperidine-3-carboxylic acid
SMILESO=C(O)C1CCC(c2ccc(O)cc2)NC1
InChIInChI=1S/C12H15NO3/c14-10-4-1-8(2-5-10)11-6-3-9(7-13-11)12(15)16/h1-2,4-5,9,11,13-14H,3,6-7H2,(H,15,16)
InChIKeyIQTZHPMSWXWAKQ-UHFFFAOYSA-N
MW221.26 g/mol
LogP1.52
Rot. Bonds2

About 6-(4-hydroxyphenyl)piperidine-3-carboxylic acid

6-(4-hydroxyphenyl)piperidine-3-carboxylic acid (PubChem CID 117168119) has the molecular formula C12H15NO3 and a molecular weight of 221.26 g/mol. Its IUPAC name is 6-(4-hydroxyphenyl)piperidine-3-carboxylic acid.

Molecular Properties

Compound Name6-(4-hydroxyphenyl)piperidine-3-carboxylic acid
PubChem CID117168119
Molecular FormulaC12H15NO3
Molecular Weight221.26 g/mol
Exact Mass221.11
IUPAC Name6-(4-hydroxyphenyl)piperidine-3-carboxylic acid
SMILESO=C(O)C1CCC(c2ccc(O)cc2)NC1
InChIInChI=1S/C12H15NO3/c14-10-4-1-8(2-5-10)11-6-3-9(7-13-11)12(15)16/h1-2,4-5,9,11,13-14H,3,6-7H2,(H,15,16)
InChIKeyIQTZHPMSWXWAKQ-UHFFFAOYSA-N
XLogP1.52
TPSA69.56 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500221.26
LogP ≤ 51.52
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze 6-(4-hydroxyphenyl)piperidine-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

methyl 6-(4-hydroxyphenyl)piperidine-3-carboxylate
CID 117168120
5-(4-cyclobutylphenyl)pyrrolidine-3-carboxylic acid
CID 117365462
5-(4-bromophenyl)pyrrolidine-3-carboxylic acid
CID 82625541
6-(2-chlorophenyl)piperidine-3-carboxylic acid
CID 117168140
5-[4-(difluoromethyl)phenyl]pyrrolidine-3-carboxylic acid
CID 117354565
5-[4-(2-hydroxypropan-2-yl)phenyl]pyrrolidine-3-carboxylic acid
CID 117116960
4-piperidin-2-ylphenol
CID 19711202
5-[4-(1-methylazetidin-3-yl)phenyl]pyrrolidine-3-carboxylic acid
CID 117405334
(4R)-4-(4-hydroxyphenyl)imidazolidin-2-one
CID 130739851
5-(4-bromo-3-fluorophenyl)pyrrolidine-3-carboxylic acid
CID 117464706
6-(1,2,4-thiadiazol-5-yl)piperidine-3-carboxylic acid
CID 112716984
5-[4-(2-methoxyethoxy)phenyl]pyrrolidine-3-carboxylic acid
CID 117416959

Frequently Asked Questions

What is the IUPAC name of 6-(4-hydroxyphenyl)piperidine-3-carboxylic acid?
The IUPAC name of 6-(4-hydroxyphenyl)piperidine-3-carboxylic acid (CID 117168119) is 6-(4-hydroxyphenyl)piperidine-3-carboxylic acid.
What is the SMILES notation for 6-(4-hydroxyphenyl)piperidine-3-carboxylic acid?
The canonical SMILES for 6-(4-hydroxyphenyl)piperidine-3-carboxylic acid is O=C(O)C1CCC(c2ccc(O)cc2)NC1.
What is the InChIKey of 6-(4-hydroxyphenyl)piperidine-3-carboxylic acid?
The InChIKey is IQTZHPMSWXWAKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO3/c14-10-4-1-8(2-5-10)11-6-3-9(7-13-11)12(15)16/h1-2,4-5,9,11,13-14H,3,6-7H2,(H,15,16).
What are the key properties of 6-(4-hydroxyphenyl)piperidine-3-carboxylic acid?
6-(4-hydroxyphenyl)piperidine-3-carboxylic acid has a molecular weight of 221.26 g/mol, XLogP of 1.52, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(4-hydroxyphenyl)piperidine-3-carboxylic acid is sourced from PubChem (CID 117168119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).