2-[2-(thiolan-3-ylmethyl)-1,3-dioxolan-4-yl]acetic acid

C10H16O4S — CID 117168570

IUPAC2-[2-(thiolan-3-ylmethyl)-1,3-dioxolan-4-yl]acetic acid
SMILESO=C(O)CC1COC(CC2CCSC2)O1
InChIInChI=1S/C10H16O4S/c11-9(12)4-8-5-13-10(14-8)3-7-1-2-15-6-7/h7-8,10H,1-6H2,(H,11,12)
InChIKeyMHVRMNZCKXDMQT-UHFFFAOYSA-N
MW232.30 g/mol
LogP1.35
Rot. Bonds4

About 2-[2-(thiolan-3-ylmethyl)-1,3-dioxolan-4-yl]acetic acid

2-[2-(thiolan-3-ylmethyl)-1,3-dioxolan-4-yl]acetic acid (PubChem CID 117168570) has the molecular formula C10H16O4S and a molecular weight of 232.30 g/mol. Its IUPAC name is 2-[2-(thiolan-3-ylmethyl)-1,3-dioxolan-4-yl]acetic acid.

Molecular Properties

Compound Name2-[2-(thiolan-3-ylmethyl)-1,3-dioxolan-4-yl]acetic acid
PubChem CID117168570
Molecular FormulaC10H16O4S
Molecular Weight232.30 g/mol
Exact Mass232.08
IUPAC Name2-[2-(thiolan-3-ylmethyl)-1,3-dioxolan-4-yl]acetic acid
SMILESO=C(O)CC1COC(CC2CCSC2)O1
InChIInChI=1S/C10H16O4S/c11-9(12)4-8-5-13-10(14-8)3-7-1-2-15-6-7/h7-8,10H,1-6H2,(H,11,12)
InChIKeyMHVRMNZCKXDMQT-UHFFFAOYSA-N
XLogP1.35
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500232.30
LogP ≤ 51.35
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-[2-(thiolan-3-ylmethyl)-1,3-dioxolan-4-yl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[2-(thiolan-3-ylmethyl)-1,3-dioxolan-4-yl]acetic acid?
The IUPAC name of 2-[2-(thiolan-3-ylmethyl)-1,3-dioxolan-4-yl]acetic acid (CID 117168570) is 2-[2-(thiolan-3-ylmethyl)-1,3-dioxolan-4-yl]acetic acid.
What is the SMILES notation for 2-[2-(thiolan-3-ylmethyl)-1,3-dioxolan-4-yl]acetic acid?
The canonical SMILES for 2-[2-(thiolan-3-ylmethyl)-1,3-dioxolan-4-yl]acetic acid is O=C(O)CC1COC(CC2CCSC2)O1.
What is the InChIKey of 2-[2-(thiolan-3-ylmethyl)-1,3-dioxolan-4-yl]acetic acid?
The InChIKey is MHVRMNZCKXDMQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O4S/c11-9(12)4-8-5-13-10(14-8)3-7-1-2-15-6-7/h7-8,10H,1-6H2,(H,11,12).
What are the key properties of 2-[2-(thiolan-3-ylmethyl)-1,3-dioxolan-4-yl]acetic acid?
2-[2-(thiolan-3-ylmethyl)-1,3-dioxolan-4-yl]acetic acid has a molecular weight of 232.30 g/mol, XLogP of 1.35, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(thiolan-3-ylmethyl)-1,3-dioxolan-4-yl]acetic acid is sourced from PubChem (CID 117168570), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).