C12H20O4S — CID 117168706
3-[2-(thian-4-ylmethyl)-1,3-dioxolan-4-yl]propanoic acid (PubChem CID 117168706) has the molecular formula C12H20O4S and a molecular weight of 260.35 g/mol. Its IUPAC name is 3-[2-(thian-4-ylmethyl)-1,3-dioxolan-4-yl]propanoic acid.
| Compound Name | 3-[2-(thian-4-ylmethyl)-1,3-dioxolan-4-yl]propanoic acid |
|---|---|
| PubChem CID | 117168706 |
| Molecular Formula | C12H20O4S |
| Molecular Weight | 260.35 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | 3-[2-(thian-4-ylmethyl)-1,3-dioxolan-4-yl]propanoic acid |
| SMILES | O=C(O)CCC1COC(CC2CCSCC2)O1 |
| InChI | InChI=1S/C12H20O4S/c13-11(14)2-1-10-8-15-12(16-10)7-9-3-5-17-6-4-9/h9-10,12H,1-8H2,(H,13,14) |
| InChIKey | LBGYGONKHPHMLS-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.35 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |