C11H18O5 — CID 117168506
3-[2-(oxan-4-yl)-1,3-dioxolan-4-yl]propanoic acid (PubChem CID 117168506) has the molecular formula C11H18O5 and a molecular weight of 230.26 g/mol. Its IUPAC name is 3-[2-(oxan-4-yl)-1,3-dioxolan-4-yl]propanoic acid.
| Compound Name | 3-[2-(oxan-4-yl)-1,3-dioxolan-4-yl]propanoic acid |
|---|---|
| PubChem CID | 117168506 |
| Molecular Formula | C11H18O5 |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | 3-[2-(oxan-4-yl)-1,3-dioxolan-4-yl]propanoic acid |
| SMILES | O=C(O)CCC1COC(C2CCOCC2)O1 |
| InChI | InChI=1S/C11H18O5/c12-10(13)2-1-9-7-15-11(16-9)8-3-5-14-6-4-8/h8-9,11H,1-7H2,(H,12,13) |
| InChIKey | PAGKTNWWLGNBIW-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |