C12H20O4S — CID 117169257
methyl 2-[2-(thian-3-ylmethyl)-1,3-dioxolan-4-yl]acetate (PubChem CID 117169257) has the molecular formula C12H20O4S and a molecular weight of 260.35 g/mol. Its IUPAC name is methyl 2-[2-(thian-3-ylmethyl)-1,3-dioxolan-4-yl]acetate.
| Compound Name | methyl 2-[2-(thian-3-ylmethyl)-1,3-dioxolan-4-yl]acetate |
|---|---|
| PubChem CID | 117169257 |
| Molecular Formula | C12H20O4S |
| Molecular Weight | 260.35 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | methyl 2-[2-(thian-3-ylmethyl)-1,3-dioxolan-4-yl]acetate |
| SMILES | COC(=O)CC1COC(CC2CCCSC2)O1 |
| InChI | InChI=1S/C12H20O4S/c1-14-11(13)6-10-7-15-12(16-10)5-9-3-2-4-17-8-9/h9-10,12H,2-8H2,1H3 |
| InChIKey | JMHKYFKETQHULA-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.35 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |