C11H18O4S — CID 117168474
2-[2-methyl-2-(thian-4-yl)-1,3-dioxolan-4-yl]acetic acid (PubChem CID 117168474) has the molecular formula C11H18O4S and a molecular weight of 246.33 g/mol. Its IUPAC name is 2-[2-methyl-2-(thian-4-yl)-1,3-dioxolan-4-yl]acetic acid.
| Compound Name | 2-[2-methyl-2-(thian-4-yl)-1,3-dioxolan-4-yl]acetic acid |
|---|---|
| PubChem CID | 117168474 |
| Molecular Formula | C11H18O4S |
| Molecular Weight | 246.33 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | 2-[2-methyl-2-(thian-4-yl)-1,3-dioxolan-4-yl]acetic acid |
| SMILES | CC1(C2CCSCC2)OCC(CC(=O)O)O1 |
| InChI | InChI=1S/C11H18O4S/c1-11(8-2-4-16-5-3-8)14-7-9(15-11)6-10(12)13/h8-9H,2-7H2,1H3,(H,12,13) |
| InChIKey | UVROUQKJZAFSHI-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.33 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |