About (6S)-1,4-dioxa-8-thiaspiro[4.5]decane-6-carboxylic acid
(6S)-1,4-dioxa-8-thiaspiro[4.5]decane-6-carboxylic acid (PubChem CID 130731604) has the molecular formula C8H12O4S
and a molecular weight of 204.25 g/mol. Its IUPAC name is (6S)-1,4-dioxa-8-thiaspiro[4.5]decane-6-carboxylic acid.
Analyze (6S)-1,4-dioxa-8-thiaspiro[4.5]decane-6-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6S)-1,4-dioxa-8-thiaspiro[4.5]decane-6-carboxylic acid?
The IUPAC name of (6S)-1,4-dioxa-8-thiaspiro[4.5]decane-6-carboxylic acid (CID 130731604) is (6S)-1,4-dioxa-8-thiaspiro[4.5]decane-6-carboxylic acid.
What is the SMILES notation for (6S)-1,4-dioxa-8-thiaspiro[4.5]decane-6-carboxylic acid?
The canonical SMILES for (6S)-1,4-dioxa-8-thiaspiro[4.5]decane-6-carboxylic acid is O=C(O)[C@H]1CSCCC12OCCO2.
What is the InChIKey of (6S)-1,4-dioxa-8-thiaspiro[4.5]decane-6-carboxylic acid?
The InChIKey is OCBDUACINCGEHB-ZCFIWIBFSA-N. The full InChI is InChI=1S/C8H12O4S/c9-7(10)6-5-13-4-1-8(6)11-2-3-12-8/h6H,1-5H2,(H,9,10)/t6-/m1/s1.
What are the key properties of (6S)-1,4-dioxa-8-thiaspiro[4.5]decane-6-carboxylic acid?
(6S)-1,4-dioxa-8-thiaspiro[4.5]decane-6-carboxylic acid has a molecular weight of 204.25 g/mol, XLogP of 0.57, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (6S)-1,4-dioxa-8-thiaspiro[4.5]decane-6-carboxylic acid is sourced from PubChem (CID 130731604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).