C7H10O4S — CID 83817933
1,4-dioxa-7-thiaspiro[4.4]nonane-9-carboxylic acid (PubChem CID 83817933) has the molecular formula C7H10O4S and a molecular weight of 190.22 g/mol. Its IUPAC name is 1,4-dioxa-7-thiaspiro[4.4]nonane-9-carboxylic acid.
| Compound Name | 1,4-dioxa-7-thiaspiro[4.4]nonane-9-carboxylic acid |
|---|---|
| PubChem CID | 83817933 |
| Molecular Formula | C7H10O4S |
| Molecular Weight | 190.22 g/mol |
| Exact Mass | 190.03 |
| IUPAC Name | 1,4-dioxa-7-thiaspiro[4.4]nonane-9-carboxylic acid |
| SMILES | O=C(O)C1CSCC12OCCO2 |
| InChI | InChI=1S/C7H10O4S/c8-6(9)5-3-12-4-7(5)10-1-2-11-7/h5H,1-4H2,(H,8,9) |
| InChIKey | GQOSAGOHVFATAS-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.22 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |