C15H24O13S2 — CID 141468382
[2-[[(2R,3S,4S)-3,4-dihydroxy-2-(hydroxymethyl)thiolan-1-ium-1-yl]methyl]-2-(1,3-dimethoxy-1,3-dioxopropan-2-yl)-1,3-dioxan-5-yl] sulfate (PubChem CID 141468382) has the molecular formula C15H24O13S2 and a molecular weight of 476.48 g/mol. Its IUPAC name is [2-[[(2R,3S,4S)-3,4-dihydroxy-2-(hydroxymethyl)thiolan-1-ium-1-yl]methyl]-2-(1,3-dimethoxy-1,3-dioxopropan-2-yl)-1,3-dioxan-5-yl] sulfate.
| Compound Name | [2-[[(2R,3S,4S)-3,4-dihydroxy-2-(hydroxymethyl)thiolan-1-ium-1-yl]methyl]-2-(1,3-dimethoxy-1,3-dioxopropan-2-yl)-1,3-dioxan-5-yl] sulfate |
|---|---|
| PubChem CID | 141468382 |
| Molecular Formula | C15H24O13S2 |
| Molecular Weight | 476.48 g/mol |
| Exact Mass | 476.07 |
| IUPAC Name | [2-[[(2R,3S,4S)-3,4-dihydroxy-2-(hydroxymethyl)thiolan-1-ium-1-yl]methyl]-2-(1,3-dimethoxy-1,3-dioxopropan-2-yl)-1,3-dioxan-5-yl] sulfate |
| SMILES | COC(=O)C(C(=O)OC)C1(C[S+]2C[C@@H](O)[C@H](O)[C@H]2CO)OCC(OS(=O)(=O)[O-])CO1 |
| InChI | InChI=1S/C15H24O13S2/c1-24-13(19)11(14(20)25-2)15(7-29-6-9(17)12(18)10(29)3-16)26-4-8(5-27-15)28-30(21,22)23/h8-12,16-18H,3-7H2,1-2H3/t8?,9-,10-,12+,15?,29?/m1/s1 |
| InChIKey | CNDPXFZSHOYQKW-CDDFHKAWSA-N |
| XLogP | -3.75 |
| TPSA | 198.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.48 |
| LogP ≤ 5 | -3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|