C17H29O13S2+ — CID 140834559
diethyl 2-[(4S,5S)-4-[[(2R,3S,4S)-3,4-dihydroxy-2-(hydroxymethyl)thiolan-1-ium-1-yl]methyl]-5-sulfooxy-1,3-dioxan-2-yl]propanedioate (PubChem CID 140834559) has the molecular formula C17H29O13S2+ and a molecular weight of 505.54 g/mol. Its IUPAC name is diethyl 2-[(4S,5S)-4-[[(2R,3S,4S)-3,4-dihydroxy-2-(hydroxymethyl)thiolan-1-ium-1-yl]methyl]-5-sulfooxy-1,3-dioxan-2-yl]propanedioate.
| Compound Name | diethyl 2-[(4S,5S)-4-[[(2R,3S,4S)-3,4-dihydroxy-2-(hydroxymethyl)thiolan-1-ium-1-yl]methyl]-5-sulfooxy-1,3-dioxan-2-yl]propanedioate |
|---|---|
| PubChem CID | 140834559 |
| Molecular Formula | C17H29O13S2+ |
| Molecular Weight | 505.54 g/mol |
| Exact Mass | 505.10 |
| IUPAC Name | diethyl 2-[(4S,5S)-4-[[(2R,3S,4S)-3,4-dihydroxy-2-(hydroxymethyl)thiolan-1-ium-1-yl]methyl]-5-sulfooxy-1,3-dioxan-2-yl]propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)C1OC[C@H](OS(=O)(=O)O)[C@@H](C[S+]2C[C@@H](O)[C@H](O)[C@H]2CO)O1 |
| InChI | InChI=1S/C17H28O13S2/c1-3-26-15(21)13(16(22)27-4-2)17-28-6-10(30-32(23,24)25)11(29-17)8-31-7-9(19)14(20)12(31)5-18/h9-14,17-20H,3-8H2,1-2H3/p+1/t9-,10+,11-,12-,14+,17?,31?/m1/s1 |
| InChIKey | FJEZJJGOIBKRJG-QZLWXJJNSA-O |
| XLogP | -2.63 |
| TPSA | 195.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.54 |
| LogP ≤ 5 | -2.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|