C15H25O13S2+ — CID 141468383
dimethyl 2-[2-[[(2R,3S,4S)-3,4-dihydroxy-2-(hydroxymethyl)thiolan-1-ium-1-yl]methyl]-5-sulfooxy-1,3-dioxan-2-yl]propanedioate (PubChem CID 141468383) has the molecular formula C15H25O13S2+ and a molecular weight of 477.49 g/mol. Its IUPAC name is dimethyl 2-[2-[[(2R,3S,4S)-3,4-dihydroxy-2-(hydroxymethyl)thiolan-1-ium-1-yl]methyl]-5-sulfooxy-1,3-dioxan-2-yl]propanedioate.
| Compound Name | dimethyl 2-[2-[[(2R,3S,4S)-3,4-dihydroxy-2-(hydroxymethyl)thiolan-1-ium-1-yl]methyl]-5-sulfooxy-1,3-dioxan-2-yl]propanedioate |
|---|---|
| PubChem CID | 141468383 |
| Molecular Formula | C15H25O13S2+ |
| Molecular Weight | 477.49 g/mol |
| Exact Mass | 477.07 |
| IUPAC Name | dimethyl 2-[2-[[(2R,3S,4S)-3,4-dihydroxy-2-(hydroxymethyl)thiolan-1-ium-1-yl]methyl]-5-sulfooxy-1,3-dioxan-2-yl]propanedioate |
| SMILES | COC(=O)C(C(=O)OC)C1(C[S+]2C[C@@H](O)[C@H](O)[C@H]2CO)OCC(OS(=O)(=O)O)CO1 |
| InChI | InChI=1S/C15H24O13S2/c1-24-13(19)11(14(20)25-2)15(7-29-6-9(17)12(18)10(29)3-16)26-4-8(5-27-15)28-30(21,22)23/h8-12,16-18H,3-7H2,1-2H3/p+1/t8?,9-,10-,12+,15?,29?/m1/s1 |
| InChIKey | CNDPXFZSHOYQKW-CDDFHKAWSA-O |
| XLogP | -3.41 |
| TPSA | 195.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.49 |
| LogP ≤ 5 | -3.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|