C16H29O11S2+ — CID 140763233
ethyl 2-[(4S,5S)-4-[[(2R,3S,4S)-3,4-dihydroxy-2-(hydroxymethyl)thiolan-1-ium-1-yl]methyl]-5-sulfooxy-1,3-dioxan-2-yl]butanoate (PubChem CID 140763233) has the molecular formula C16H29O11S2+ and a molecular weight of 461.53 g/mol. Its IUPAC name is ethyl 2-[(4S,5S)-4-[[(2R,3S,4S)-3,4-dihydroxy-2-(hydroxymethyl)thiolan-1-ium-1-yl]methyl]-5-sulfooxy-1,3-dioxan-2-yl]butanoate.
| Compound Name | ethyl 2-[(4S,5S)-4-[[(2R,3S,4S)-3,4-dihydroxy-2-(hydroxymethyl)thiolan-1-ium-1-yl]methyl]-5-sulfooxy-1,3-dioxan-2-yl]butanoate |
|---|---|
| PubChem CID | 140763233 |
| Molecular Formula | C16H29O11S2+ |
| Molecular Weight | 461.53 g/mol |
| Exact Mass | 461.11 |
| IUPAC Name | ethyl 2-[(4S,5S)-4-[[(2R,3S,4S)-3,4-dihydroxy-2-(hydroxymethyl)thiolan-1-ium-1-yl]methyl]-5-sulfooxy-1,3-dioxan-2-yl]butanoate |
| SMILES | CCOC(=O)C(CC)C1OC[C@H](OS(=O)(=O)O)[C@@H](C[S+]2C[C@@H](O)[C@H](O)[C@H]2CO)O1 |
| InChI | InChI=1S/C16H28O11S2/c1-3-9(15(20)24-4-2)16-25-6-11(27-29(21,22)23)12(26-16)8-28-7-10(18)14(19)13(28)5-17/h9-14,16-19H,3-8H2,1-2H3/p+1/t9?,10-,11+,12-,13-,14+,16?,28?/m1/s1 |
| InChIKey | XNMYKUAIZUOAQE-FQHOATKNSA-O |
| XLogP | -1.78 |
| TPSA | 169.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.53 |
| LogP ≤ 5 | -1.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|