C14H25O11S2+ — CID 140763230
methyl 2-[(4S,5S)-4-[[(2R,3S,4S)-3,4-dihydroxy-2-(hydroxymethyl)thiolan-1-ium-1-yl]methyl]-5-sulfooxy-1,3-dioxan-2-yl]propanoate (PubChem CID 140763230) has the molecular formula C14H25O11S2+ and a molecular weight of 433.48 g/mol. Its IUPAC name is methyl 2-[(4S,5S)-4-[[(2R,3S,4S)-3,4-dihydroxy-2-(hydroxymethyl)thiolan-1-ium-1-yl]methyl]-5-sulfooxy-1,3-dioxan-2-yl]propanoate.
| Compound Name | methyl 2-[(4S,5S)-4-[[(2R,3S,4S)-3,4-dihydroxy-2-(hydroxymethyl)thiolan-1-ium-1-yl]methyl]-5-sulfooxy-1,3-dioxan-2-yl]propanoate |
|---|---|
| PubChem CID | 140763230 |
| Molecular Formula | C14H25O11S2+ |
| Molecular Weight | 433.48 g/mol |
| Exact Mass | 433.08 |
| IUPAC Name | methyl 2-[(4S,5S)-4-[[(2R,3S,4S)-3,4-dihydroxy-2-(hydroxymethyl)thiolan-1-ium-1-yl]methyl]-5-sulfooxy-1,3-dioxan-2-yl]propanoate |
| SMILES | COC(=O)C(C)C1OC[C@H](OS(=O)(=O)O)[C@@H](C[S+]2C[C@@H](O)[C@H](O)[C@H]2CO)O1 |
| InChI | InChI=1S/C14H24O11S2/c1-7(13(18)22-2)14-23-4-9(25-27(19,20)21)10(24-14)6-26-5-8(16)12(17)11(26)3-15/h7-12,14-17H,3-6H2,1-2H3/p+1/t7?,8-,9+,10-,11-,12+,14?,26?/m1/s1 |
| InChIKey | CQWHEBPYGOOZEO-MBFZRGRASA-O |
| XLogP | -2.56 |
| TPSA | 169.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.48 |
| LogP ≤ 5 | -2.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|