C17H28O13S2 — CID 140834558
[(4S,5S)-2-(1,3-diethoxy-1,3-dioxopropan-2-yl)-4-[[(2R,3S,4S)-3,4-dihydroxy-2-(hydroxymethyl)thiolan-1-ium-1-yl]methyl]-1,3-dioxan-5-yl] sulfate (PubChem CID 140834558) has the molecular formula C17H28O13S2 and a molecular weight of 504.53 g/mol. Its IUPAC name is [(4S,5S)-2-(1,3-diethoxy-1,3-dioxopropan-2-yl)-4-[[(2R,3S,4S)-3,4-dihydroxy-2-(hydroxymethyl)thiolan-1-ium-1-yl]methyl]-1,3-dioxan-5-yl] sulfate.
| Compound Name | [(4S,5S)-2-(1,3-diethoxy-1,3-dioxopropan-2-yl)-4-[[(2R,3S,4S)-3,4-dihydroxy-2-(hydroxymethyl)thiolan-1-ium-1-yl]methyl]-1,3-dioxan-5-yl] sulfate |
|---|---|
| PubChem CID | 140834558 |
| Molecular Formula | C17H28O13S2 |
| Molecular Weight | 504.53 g/mol |
| Exact Mass | 504.10 |
| IUPAC Name | [(4S,5S)-2-(1,3-diethoxy-1,3-dioxopropan-2-yl)-4-[[(2R,3S,4S)-3,4-dihydroxy-2-(hydroxymethyl)thiolan-1-ium-1-yl]methyl]-1,3-dioxan-5-yl] sulfate |
| SMILES | CCOC(=O)C(C(=O)OCC)C1OC[C@H](OS(=O)(=O)[O-])[C@@H](C[S+]2C[C@@H](O)[C@H](O)[C@H]2CO)O1 |
| InChI | InChI=1S/C17H28O13S2/c1-3-26-15(21)13(16(22)27-4-2)17-28-6-10(30-32(23,24)25)11(29-17)8-31-7-9(19)14(20)12(31)5-18/h9-14,17-20H,3-8H2,1-2H3/t9-,10+,11-,12-,14+,17?,31?/m1/s1 |
| InChIKey | FJEZJJGOIBKRJG-QZLWXJJNSA-N |
| XLogP | -2.97 |
| TPSA | 198.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.53 |
| LogP ≤ 5 | -2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|