C10H14O3S — CID 117169327
2-[2-(5-methylthiophen-2-yl)-1,3-dioxolan-4-yl]ethanol (PubChem CID 117169327) has the molecular formula C10H14O3S and a molecular weight of 214.29 g/mol. Its IUPAC name is 2-[2-(5-methylthiophen-2-yl)-1,3-dioxolan-4-yl]ethanol.
| Compound Name | 2-[2-(5-methylthiophen-2-yl)-1,3-dioxolan-4-yl]ethanol |
|---|---|
| PubChem CID | 117169327 |
| Molecular Formula | C10H14O3S |
| Molecular Weight | 214.29 g/mol |
| Exact Mass | 214.07 |
| IUPAC Name | 2-[2-(5-methylthiophen-2-yl)-1,3-dioxolan-4-yl]ethanol |
| SMILES | Cc1ccc(C2OCC(CCO)O2)s1 |
| InChI | InChI=1S/C10H14O3S/c1-7-2-3-9(14-7)10-12-6-8(13-10)4-5-11/h2-3,8,10-11H,4-6H2,1H3 |
| InChIKey | XBZFNGODDFXCPY-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.29 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |