C10H11NO3S — CID 117170557
[4-(aminomethyl)-1,1-dioxo-1-benzothiophen-3-yl]methanol (PubChem CID 117170557) has the molecular formula C10H11NO3S and a molecular weight of 225.27 g/mol. Its IUPAC name is [4-(aminomethyl)-1,1-dioxo-1-benzothiophen-3-yl]methanol.
| Compound Name | [4-(aminomethyl)-1,1-dioxo-1-benzothiophen-3-yl]methanol |
|---|---|
| PubChem CID | 117170557 |
| Molecular Formula | C10H11NO3S |
| Molecular Weight | 225.27 g/mol |
| Exact Mass | 225.05 |
| IUPAC Name | [4-(aminomethyl)-1,1-dioxo-1-benzothiophen-3-yl]methanol |
| SMILES | NCc1cccc2c1C(CO)=CS2(=O)=O |
| InChI | InChI=1S/C10H11NO3S/c11-4-7-2-1-3-9-10(7)8(5-12)6-15(9,13)14/h1-3,6,12H,4-5,11H2 |
| InChIKey | NGZLBEYBNFISKO-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.27 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |