About N-[[7-(aminomethyl)-1,1-dioxo-1-benzothiophen-3-yl]methyl]propan-2-amine
N-[[7-(aminomethyl)-1,1-dioxo-1-benzothiophen-3-yl]methyl]propan-2-amine (PubChem CID 117181222) has the molecular formula C13H18N2O2S
and a molecular weight of 266.37 g/mol. Its IUPAC name is N-[[7-(aminomethyl)-1,1-dioxo-1-benzothiophen-3-yl]methyl]propan-2-amine.
Molecular Properties
| Compound Name | N-[[7-(aminomethyl)-1,1-dioxo-1-benzothiophen-3-yl]methyl]propan-2-amine |
| PubChem CID | 117181222 |
| Molecular Formula | C13H18N2O2S |
| Molecular Weight | 266.37 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | N-[[7-(aminomethyl)-1,1-dioxo-1-benzothiophen-3-yl]methyl]propan-2-amine |
| SMILES | CC(C)NCC1=CS(=O)(=O)c2c(CN)cccc21 |
| InChI | InChI=1S/C13H18N2O2S/c1-9(2)15-7-11-8-18(16,17)13-10(6-14)4-3-5-12(11)13/h3-5,8-9,15H,6-7,14H2,1-2H3 |
| InChIKey | UKNXQZPIFLOMJN-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.37 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[[7-(aminomethyl)-1,1-dioxo-1-benzothiophen-3-yl]methyl]propan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[7-(aminomethyl)-1,1-dioxo-1-benzothiophen-3-yl]methyl]propan-2-amine?
The IUPAC name of N-[[7-(aminomethyl)-1,1-dioxo-1-benzothiophen-3-yl]methyl]propan-2-amine (CID 117181222) is N-[[7-(aminomethyl)-1,1-dioxo-1-benzothiophen-3-yl]methyl]propan-2-amine.
What is the SMILES notation for N-[[7-(aminomethyl)-1,1-dioxo-1-benzothiophen-3-yl]methyl]propan-2-amine?
The canonical SMILES for N-[[7-(aminomethyl)-1,1-dioxo-1-benzothiophen-3-yl]methyl]propan-2-amine is CC(C)NCC1=CS(=O)(=O)c2c(CN)cccc21.
What is the InChIKey of N-[[7-(aminomethyl)-1,1-dioxo-1-benzothiophen-3-yl]methyl]propan-2-amine?
The InChIKey is UKNXQZPIFLOMJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N2O2S/c1-9(2)15-7-11-8-18(16,17)13-10(6-14)4-3-5-12(11)13/h3-5,8-9,15H,6-7,14H2,1-2H3.
What are the key properties of N-[[7-(aminomethyl)-1,1-dioxo-1-benzothiophen-3-yl]methyl]propan-2-amine?
N-[[7-(aminomethyl)-1,1-dioxo-1-benzothiophen-3-yl]methyl]propan-2-amine has a molecular weight of 266.37 g/mol, XLogP of 1.27, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[7-(aminomethyl)-1,1-dioxo-1-benzothiophen-3-yl]methyl]propan-2-amine is sourced from PubChem (CID 117181222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).