C12H15BrN2 — CID 117173114
1-(4-bromo-1-methylindol-2-yl)-N,N-dimethylmethanamine (PubChem CID 117173114) has the molecular formula C12H15BrN2 and a molecular weight of 267.17 g/mol. Its IUPAC name is 1-(4-bromo-1-methylindol-2-yl)-N,N-dimethylmethanamine.
| Compound Name | 1-(4-bromo-1-methylindol-2-yl)-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 117173114 |
| Molecular Formula | C12H15BrN2 |
| Molecular Weight | 267.17 g/mol |
| Exact Mass | 266.04 |
| IUPAC Name | 1-(4-bromo-1-methylindol-2-yl)-N,N-dimethylmethanamine |
| SMILES | CN(C)Cc1cc2c(Br)cccc2n1C |
| InChI | InChI=1S/C12H15BrN2/c1-14(2)8-9-7-10-11(13)5-4-6-12(10)15(9)3/h4-7H,8H2,1-3H3 |
| InChIKey | CJLTZCXYIFUXPD-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.17 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |