About CID 174586539
CID 174586539 (PubChem CID 174586539) has the molecular formula C10H12BrN2O2S-
and a molecular weight of 304.19 g/mol.
Molecular Properties
| Compound Name | CID 174586539 |
| PubChem CID | 174586539 |
| Molecular Formula | C10H12BrN2O2S- |
| Molecular Weight | 304.19 g/mol |
| Exact Mass | 302.98 |
| IUPAC Name | — |
| SMILES | Cc1cc2c(Br)cccc2n1C.NS(=O)[O-] |
| InChI | InChI=1S/C10H10BrN.H3NO2S/c1-7-6-8-9(11)4-3-5-10(8)12(7)2;1-4(2)3/h3-6H,1-2H3;1H2,(H,2,3)/p-1 |
| InChIKey | ZMQHQFIGQFQMGE-UHFFFAOYSA-M |
| XLogP | 1.99 |
| TPSA | 71.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.19 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze CID 174586539 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 174586539?
The IUPAC name of CID 174586539 (CID 174586539) is not available.
What is the SMILES notation for CID 174586539?
The canonical SMILES for CID 174586539 is Cc1cc2c(Br)cccc2n1C.NS(=O)[O-].
What is the InChIKey of CID 174586539?
The InChIKey is ZMQHQFIGQFQMGE-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H10BrN.H3NO2S/c1-7-6-8-9(11)4-3-5-10(8)12(7)2;1-4(2)3/h3-6H,1-2H3;1H2,(H,2,3)/p-1.
What are the key properties of CID 174586539?
CID 174586539 has a molecular weight of 304.19 g/mol, XLogP of 1.99, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 174586539 is sourced from PubChem (CID 174586539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).