C15H12FNO3S — CID 117174524
3-[(4-fluorophenoxy)methyl]-1,1-dioxo-1-benzothiophen-5-amine (PubChem CID 117174524) has the molecular formula C15H12FNO3S and a molecular weight of 305.33 g/mol. Its IUPAC name is 3-[(4-fluorophenoxy)methyl]-1,1-dioxo-1-benzothiophen-5-amine.
| Compound Name | 3-[(4-fluorophenoxy)methyl]-1,1-dioxo-1-benzothiophen-5-amine |
|---|---|
| PubChem CID | 117174524 |
| Molecular Formula | C15H12FNO3S |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.05 |
| IUPAC Name | 3-[(4-fluorophenoxy)methyl]-1,1-dioxo-1-benzothiophen-5-amine |
| SMILES | Nc1ccc2c(c1)C(COc1ccc(F)cc1)=CS2(=O)=O |
| InChI | InChI=1S/C15H12FNO3S/c16-11-1-4-13(5-2-11)20-8-10-9-21(18,19)15-6-3-12(17)7-14(10)15/h1-7,9H,8,17H2 |
| InChIKey | GZUKQPTUNFPWSY-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|