C22H32O3Si — CID 11717699
4-[2-tri(propan-2-yl)silyloxyethyl]naphthalene-1-carboxylic acid (PubChem CID 11717699) has the molecular formula C22H32O3Si and a molecular weight of 372.58 g/mol. Its IUPAC name is 4-[2-tri(propan-2-yl)silyloxyethyl]naphthalene-1-carboxylic acid.
| Compound Name | 4-[2-tri(propan-2-yl)silyloxyethyl]naphthalene-1-carboxylic acid |
|---|---|
| PubChem CID | 11717699 |
| Molecular Formula | C22H32O3Si |
| Molecular Weight | 372.58 g/mol |
| Exact Mass | 372.21 |
| IUPAC Name | 4-[2-tri(propan-2-yl)silyloxyethyl]naphthalene-1-carboxylic acid |
| SMILES | CC(C)[Si](OCCc1ccc(C(=O)O)c2ccccc12)(C(C)C)C(C)C |
| InChI | InChI=1S/C22H32O3Si/c1-15(2)26(16(3)4,17(5)6)25-14-13-18-11-12-21(22(23)24)20-10-8-7-9-19(18)20/h7-12,15-17H,13-14H2,1-6H3,(H,23,24) |
| InChIKey | SLCXUHRSOUSOQM-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.58 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|