C13H13NO2S — CID 117178191
3-[(cyclopropylamino)methyl]-1-benzothiophene-6-carboxylic acid (PubChem CID 117178191) has the molecular formula C13H13NO2S and a molecular weight of 247.32 g/mol. Its IUPAC name is 3-[(cyclopropylamino)methyl]-1-benzothiophene-6-carboxylic acid.
| Compound Name | 3-[(cyclopropylamino)methyl]-1-benzothiophene-6-carboxylic acid |
|---|---|
| PubChem CID | 117178191 |
| Molecular Formula | C13H13NO2S |
| Molecular Weight | 247.32 g/mol |
| Exact Mass | 247.07 |
| IUPAC Name | 3-[(cyclopropylamino)methyl]-1-benzothiophene-6-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(CNC3CC3)csc2c1 |
| InChI | InChI=1S/C13H13NO2S/c15-13(16)8-1-4-11-9(6-14-10-2-3-10)7-17-12(11)5-8/h1,4-5,7,10,14H,2-3,6H2,(H,15,16) |
| InChIKey | JWMWNQNAHHSMAZ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.32 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |