C10H11NO2S2 — CID 117179516
[6-(aminomethyl)-1,1-dioxo-1-benzothiophen-2-yl]methanethiol (PubChem CID 117179516) has the molecular formula C10H11NO2S2 and a molecular weight of 241.34 g/mol. Its IUPAC name is [6-(aminomethyl)-1,1-dioxo-1-benzothiophen-2-yl]methanethiol.
| Compound Name | [6-(aminomethyl)-1,1-dioxo-1-benzothiophen-2-yl]methanethiol |
|---|---|
| PubChem CID | 117179516 |
| Molecular Formula | C10H11NO2S2 |
| Molecular Weight | 241.34 g/mol |
| Exact Mass | 241.02 |
| IUPAC Name | [6-(aminomethyl)-1,1-dioxo-1-benzothiophen-2-yl]methanethiol |
| SMILES | NCc1ccc2c(c1)S(=O)(=O)C(CS)=C2 |
| InChI | InChI=1S/C10H11NO2S2/c11-5-7-1-2-8-4-9(6-14)15(12,13)10(8)3-7/h1-4,14H,5-6,11H2 |
| InChIKey | PGACDKAMRCEOSQ-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.34 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|