C24H26N2O4 — CID 11718399
5-methyl-N-[2-(3-oxobutanoylamino)ethyl]-2,2-diphenyl-3H-furan-4-carboxamide (PubChem CID 11718399) has the molecular formula C24H26N2O4 and a molecular weight of 406.48 g/mol. Its IUPAC name is 5-methyl-N-[2-(3-oxobutanoylamino)ethyl]-2,2-diphenyl-3H-furan-4-carboxamide.
| Compound Name | 5-methyl-N-[2-(3-oxobutanoylamino)ethyl]-2,2-diphenyl-3H-furan-4-carboxamide |
|---|---|
| PubChem CID | 11718399 |
| Molecular Formula | C24H26N2O4 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | 5-methyl-N-[2-(3-oxobutanoylamino)ethyl]-2,2-diphenyl-3H-furan-4-carboxamide |
| SMILES | CC(=O)CC(=O)NCCNC(=O)C1=C(C)OC(c2ccccc2)(c2ccccc2)C1 |
| InChI | InChI=1S/C24H26N2O4/c1-17(27)15-22(28)25-13-14-26-23(29)21-16-24(30-18(21)2,19-9-5-3-6-10-19)20-11-7-4-8-12-20/h3-12H,13-16H2,1-2H3,(H,25,28)(H,26,29) |
| InChIKey | ABYPCOZIPWLMOY-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|