2-(cyclopentylamino)-1,3-oxazole-5-carboxylic acid

C9H12N2O3 — CID 117190021

IUPAC2-(cyclopentylamino)-1,3-oxazole-5-carboxylic acid
SMILESO=C(O)c1cnc(NC2CCCC2)o1
InChIInChI=1S/C9H12N2O3/c12-8(13)7-5-10-9(14-7)11-6-3-1-2-4-6/h5-6H,1-4H2,(H,10,11)(H,12,13)
InChIKeyPWCILDHVZRDEHU-UHFFFAOYSA-N
MW196.21 g/mol
LogP1.73
Rot. Bonds3

About 2-(cyclopentylamino)-1,3-oxazole-5-carboxylic acid

2-(cyclopentylamino)-1,3-oxazole-5-carboxylic acid (PubChem CID 117190021) has the molecular formula C9H12N2O3 and a molecular weight of 196.21 g/mol. Its IUPAC name is 2-(cyclopentylamino)-1,3-oxazole-5-carboxylic acid.

Molecular Properties

Compound Name2-(cyclopentylamino)-1,3-oxazole-5-carboxylic acid
PubChem CID117190021
Molecular FormulaC9H12N2O3
Molecular Weight196.21 g/mol
Exact Mass196.08
IUPAC Name2-(cyclopentylamino)-1,3-oxazole-5-carboxylic acid
SMILESO=C(O)c1cnc(NC2CCCC2)o1
InChIInChI=1S/C9H12N2O3/c12-8(13)7-5-10-9(14-7)11-6-3-1-2-4-6/h5-6H,1-4H2,(H,10,11)(H,12,13)
InChIKeyPWCILDHVZRDEHU-UHFFFAOYSA-N
XLogP1.73
TPSA75.36 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500196.21
LogP ≤ 51.73
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 2-(cyclopentylamino)-1,3-oxazole-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(cyclopentylamino)-1,3-oxazole-5-carboxylic acid?
The IUPAC name of 2-(cyclopentylamino)-1,3-oxazole-5-carboxylic acid (CID 117190021) is 2-(cyclopentylamino)-1,3-oxazole-5-carboxylic acid.
What is the SMILES notation for 2-(cyclopentylamino)-1,3-oxazole-5-carboxylic acid?
The canonical SMILES for 2-(cyclopentylamino)-1,3-oxazole-5-carboxylic acid is O=C(O)c1cnc(NC2CCCC2)o1.
What is the InChIKey of 2-(cyclopentylamino)-1,3-oxazole-5-carboxylic acid?
The InChIKey is PWCILDHVZRDEHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O3/c12-8(13)7-5-10-9(14-7)11-6-3-1-2-4-6/h5-6H,1-4H2,(H,10,11)(H,12,13).
What are the key properties of 2-(cyclopentylamino)-1,3-oxazole-5-carboxylic acid?
2-(cyclopentylamino)-1,3-oxazole-5-carboxylic acid has a molecular weight of 196.21 g/mol, XLogP of 1.73, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(cyclopentylamino)-1,3-oxazole-5-carboxylic acid is sourced from PubChem (CID 117190021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).