About 2-(cyclopentylamino)-1,3-oxazole-5-carboxylic acid
2-(cyclopentylamino)-1,3-oxazole-5-carboxylic acid (PubChem CID 117190021) has the molecular formula C9H12N2O3
and a molecular weight of 196.21 g/mol. Its IUPAC name is 2-(cyclopentylamino)-1,3-oxazole-5-carboxylic acid.
Molecular Properties
| Compound Name | 2-(cyclopentylamino)-1,3-oxazole-5-carboxylic acid |
| PubChem CID | 117190021 |
| Molecular Formula | C9H12N2O3 |
| Molecular Weight | 196.21 g/mol |
| Exact Mass | 196.08 |
| IUPAC Name | 2-(cyclopentylamino)-1,3-oxazole-5-carboxylic acid |
| SMILES | O=C(O)c1cnc(NC2CCCC2)o1 |
| InChI | InChI=1S/C9H12N2O3/c12-8(13)7-5-10-9(14-7)11-6-3-1-2-4-6/h5-6H,1-4H2,(H,10,11)(H,12,13) |
| InChIKey | PWCILDHVZRDEHU-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.21 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(cyclopentylamino)-1,3-oxazole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(cyclopentylamino)-1,3-oxazole-5-carboxylic acid?
The IUPAC name of 2-(cyclopentylamino)-1,3-oxazole-5-carboxylic acid (CID 117190021) is 2-(cyclopentylamino)-1,3-oxazole-5-carboxylic acid.
What is the SMILES notation for 2-(cyclopentylamino)-1,3-oxazole-5-carboxylic acid?
The canonical SMILES for 2-(cyclopentylamino)-1,3-oxazole-5-carboxylic acid is O=C(O)c1cnc(NC2CCCC2)o1.
What is the InChIKey of 2-(cyclopentylamino)-1,3-oxazole-5-carboxylic acid?
The InChIKey is PWCILDHVZRDEHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O3/c12-8(13)7-5-10-9(14-7)11-6-3-1-2-4-6/h5-6H,1-4H2,(H,10,11)(H,12,13).
What are the key properties of 2-(cyclopentylamino)-1,3-oxazole-5-carboxylic acid?
2-(cyclopentylamino)-1,3-oxazole-5-carboxylic acid has a molecular weight of 196.21 g/mol, XLogP of 1.73, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(cyclopentylamino)-1,3-oxazole-5-carboxylic acid is sourced from PubChem (CID 117190021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).