C11H17N3O2 — CID 117191656
5-(azepan-1-ylmethyl)-1H-imidazole-2-carboxylic acid (PubChem CID 117191656) has the molecular formula C11H17N3O2 and a molecular weight of 223.28 g/mol. Its IUPAC name is 5-(azepan-1-ylmethyl)-1H-imidazole-2-carboxylic acid.
| Compound Name | 5-(azepan-1-ylmethyl)-1H-imidazole-2-carboxylic acid |
|---|---|
| PubChem CID | 117191656 |
| Molecular Formula | C11H17N3O2 |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.13 |
| IUPAC Name | 5-(azepan-1-ylmethyl)-1H-imidazole-2-carboxylic acid |
| SMILES | O=C(O)c1ncc(CN2CCCCCC2)[nH]1 |
| InChI | InChI=1S/C11H17N3O2/c15-11(16)10-12-7-9(13-10)8-14-5-3-1-2-4-6-14/h7H,1-6,8H2,(H,12,13)(H,15,16) |
| InChIKey | XYISPIXUQCEGSH-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 69.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |