C4H4N2O2S — CID 70391529
5-sulfanyl-1H-imidazole-2-carboxylic acid (PubChem CID 70391529) has the molecular formula C4H4N2O2S and a molecular weight of 144.16 g/mol. Its IUPAC name is 5-sulfanyl-1H-imidazole-2-carboxylic acid.
| Compound Name | 5-sulfanyl-1H-imidazole-2-carboxylic acid |
|---|---|
| PubChem CID | 70391529 |
| Molecular Formula | C4H4N2O2S |
| Molecular Weight | 144.16 g/mol |
| Exact Mass | 144.00 |
| IUPAC Name | 5-sulfanyl-1H-imidazole-2-carboxylic acid |
| SMILES | O=C(O)c1ncc(S)[nH]1 |
| InChI | InChI=1S/C4H4N2O2S/c7-4(8)3-5-1-2(9)6-3/h1,9H,(H,5,6)(H,7,8) |
| InChIKey | DUVICKROKHBVHP-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.16 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|