C10H6F2N2O2S — CID 138570733
4,5-difluoro-2-(5-sulfanyl-1H-imidazol-2-yl)benzoic acid (PubChem CID 138570733) has the molecular formula C10H6F2N2O2S and a molecular weight of 256.23 g/mol. Its IUPAC name is 4,5-difluoro-2-(5-sulfanyl-1H-imidazol-2-yl)benzoic acid.
| Compound Name | 4,5-difluoro-2-(5-sulfanyl-1H-imidazol-2-yl)benzoic acid |
|---|---|
| PubChem CID | 138570733 |
| Molecular Formula | C10H6F2N2O2S |
| Molecular Weight | 256.23 g/mol |
| Exact Mass | 256.01 |
| IUPAC Name | 4,5-difluoro-2-(5-sulfanyl-1H-imidazol-2-yl)benzoic acid |
| SMILES | O=C(O)c1cc(F)c(F)cc1-c1ncc(S)[nH]1 |
| InChI | InChI=1S/C10H6F2N2O2S/c11-6-1-4(9-13-3-8(17)14-9)5(10(15)16)2-7(6)12/h1-3,17H,(H,13,14)(H,15,16) |
| InChIKey | ZUUGYFVYWHFNHF-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.23 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|