C10H5F2NO2S2 — CID 138570970
4,5-difluoro-2-(2-sulfanylidene-3H-1,3-thiazol-5-yl)benzoic acid (PubChem CID 138570970) has the molecular formula C10H5F2NO2S2 and a molecular weight of 273.29 g/mol. Its IUPAC name is 4,5-difluoro-2-(2-sulfanylidene-3H-1,3-thiazol-5-yl)benzoic acid.
| Compound Name | 4,5-difluoro-2-(2-sulfanylidene-3H-1,3-thiazol-5-yl)benzoic acid |
|---|---|
| PubChem CID | 138570970 |
| Molecular Formula | C10H5F2NO2S2 |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 272.97 |
| IUPAC Name | 4,5-difluoro-2-(2-sulfanylidene-3H-1,3-thiazol-5-yl)benzoic acid |
| SMILES | O=C(O)c1cc(F)c(F)cc1-c1c[nH]c(=S)s1 |
| InChI | InChI=1S/C10H5F2NO2S2/c11-6-1-4(8-3-13-10(16)17-8)5(9(14)15)2-7(6)12/h1-3H,(H,13,16)(H,14,15) |
| InChIKey | LZVVAHDULCERLE-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|