About N-[(2-methyl-1,3-oxazol-5-yl)methyl]cyclopropanamine
N-[(2-methyl-1,3-oxazol-5-yl)methyl]cyclopropanamine (PubChem CID 117192172) has the molecular formula C8H12N2O
and a molecular weight of 152.20 g/mol. Its IUPAC name is N-[(2-methyl-1,3-oxazol-5-yl)methyl]cyclopropanamine.
Analyze N-[(2-methyl-1,3-oxazol-5-yl)methyl]cyclopropanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2-methyl-1,3-oxazol-5-yl)methyl]cyclopropanamine?
The IUPAC name of N-[(2-methyl-1,3-oxazol-5-yl)methyl]cyclopropanamine (CID 117192172) is N-[(2-methyl-1,3-oxazol-5-yl)methyl]cyclopropanamine.
What is the SMILES notation for N-[(2-methyl-1,3-oxazol-5-yl)methyl]cyclopropanamine?
The canonical SMILES for N-[(2-methyl-1,3-oxazol-5-yl)methyl]cyclopropanamine is Cc1ncc(CNC2CC2)o1.
What is the InChIKey of N-[(2-methyl-1,3-oxazol-5-yl)methyl]cyclopropanamine?
The InChIKey is ZNSAIYJUVJRMCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O/c1-6-9-4-8(11-6)5-10-7-2-3-7/h4,7,10H,2-3,5H2,1H3.
What are the key properties of N-[(2-methyl-1,3-oxazol-5-yl)methyl]cyclopropanamine?
N-[(2-methyl-1,3-oxazol-5-yl)methyl]cyclopropanamine has a molecular weight of 152.20 g/mol, XLogP of 1.24, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2-methyl-1,3-oxazol-5-yl)methyl]cyclopropanamine is sourced from PubChem (CID 117192172), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).